C20H36O4Si — CID 11210861
tert-butyl-[(E,2S)-2-methoxy-6-methyl-7-(oxan-2-yloxy)hept-5-en-3-ynoxy]-dimethylsilane (PubChem CID 11210861) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is tert-butyl-[(E,2S)-2-methoxy-6-methyl-7-(oxan-2-yloxy)hept-5-en-3-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,2S)-2-methoxy-6-methyl-7-(oxan-2-yloxy)hept-5-en-3-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11210861 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | tert-butyl-[(E,2S)-2-methoxy-6-methyl-7-(oxan-2-yloxy)hept-5-en-3-ynoxy]-dimethylsilane |
| SMILES | CO[C@@H](C#C/C=C(\C)COC1CCCCO1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O4Si/c1-17(15-23-19-13-8-9-14-22-19)11-10-12-18(21-5)16-24-25(6,7)20(2,3)4/h11,18-19H,8-9,13-16H2,1-7H3/b17-11+/t18-,19?/m0/s1 |
| InChIKey | MXOMLIQQZDXPMA-YHSZHDMLSA-N |
| XLogP | 4.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|