About 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole
5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole (PubChem CID 11210958) has the molecular formula C21H26ClN3O
and a molecular weight of 371.91 g/mol. Its IUPAC name is 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole.
Molecular Properties
| Compound Name | 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole |
| PubChem CID | 11210958 |
| Molecular Formula | C21H26ClN3O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole |
| SMILES | COc1c(-n2nc3ccc(Cl)cc3n2)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C21H26ClN3O/c1-20(2,3)13-10-15(21(4,5)6)19(26-7)18(11-13)25-23-16-9-8-14(22)12-17(16)24-25/h8-12H,1-7H3 |
| InChIKey | DKFFRHXOLSDKKQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole?
The IUPAC name of 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole (CID 11210958) is 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole.
What is the SMILES notation for 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole?
The canonical SMILES for 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole is COc1c(-n2nc3ccc(Cl)cc3n2)cc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole?
The InChIKey is DKFFRHXOLSDKKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26ClN3O/c1-20(2,3)13-10-15(21(4,5)6)19(26-7)18(11-13)25-23-16-9-8-14(22)12-17(16)24-25/h8-12H,1-7H3.
What are the key properties of 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole?
5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole has a molecular weight of 371.91 g/mol, XLogP of 5.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(3,5-ditert-butyl-2-methoxyphenyl)benzotriazole is sourced from PubChem (CID 11210958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).