C21H40O5 — CID 11210991
(2R,3S,4S,6R,7S)-3,7-dimethyl-1-[(4S,5S,6R)-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxan-4-yl]non-8-ene-2,4,6-triol (PubChem CID 11210991) has the molecular formula C21H40O5 and a molecular weight of 372.55 g/mol. Its IUPAC name is (2R,3S,4S,6R,7S)-3,7-dimethyl-1-[(4S,5S,6R)-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxan-4-yl]non-8-ene-2,4,6-triol.
| Compound Name | (2R,3S,4S,6R,7S)-3,7-dimethyl-1-[(4S,5S,6R)-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxan-4-yl]non-8-ene-2,4,6-triol |
|---|---|
| PubChem CID | 11210991 |
| Molecular Formula | C21H40O5 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | (2R,3S,4S,6R,7S)-3,7-dimethyl-1-[(4S,5S,6R)-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxan-4-yl]non-8-ene-2,4,6-triol |
| SMILES | C=C[C@H](C)[C@H](O)C[C@H](O)[C@H](C)[C@H](O)C[C@@H]1OC(C)(C)O[C@H](C(C)C)[C@H]1C |
| InChI | InChI=1S/C21H40O5/c1-9-13(4)16(22)10-17(23)14(5)18(24)11-19-15(6)20(12(2)3)26-21(7,8)25-19/h9,12-20,22-24H,1,10-11H2,2-8H3/t13-,14-,15-,16+,17-,18+,19-,20+/m0/s1 |
| InChIKey | GYTVEFILJWUEOP-AOOVSPCUSA-N |
| XLogP | 3.12 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|