C22H31NO4 — CID 11211021
methyl (2S,3S,4aS,5S,8aR)-3-(methoxymethoxy)-2-methyl-5-[(E)-2-phenylethenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate (PubChem CID 11211021) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is methyl (2S,3S,4aS,5S,8aR)-3-(methoxymethoxy)-2-methyl-5-[(E)-2-phenylethenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate.
| Compound Name | methyl (2S,3S,4aS,5S,8aR)-3-(methoxymethoxy)-2-methyl-5-[(E)-2-phenylethenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 11211021 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | methyl (2S,3S,4aS,5S,8aR)-3-(methoxymethoxy)-2-methyl-5-[(E)-2-phenylethenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxylate |
| SMILES | COCO[C@H]1C[C@H]2[C@H](/C=C/c3ccccc3)CCC[C@H]2N(C(=O)OC)[C@H]1C |
| InChI | InChI=1S/C22H31NO4/c1-16-21(27-15-25-2)14-19-18(13-12-17-8-5-4-6-9-17)10-7-11-20(19)23(16)22(24)26-3/h4-6,8-9,12-13,16,18-21H,7,10-11,14-15H2,1-3H3/b13-12+/t16-,18-,19-,20+,21-/m0/s1 |
| InChIKey | UYSGFCCNOONYOM-CHHAHHBNSA-N |
| XLogP | 4.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|