C22H34O5 — CID 11211143
methyl (1'R,2'S,3'R,3'aS,6'aR)-2'-hydroxy-5,5-dimethyl-1'-(2-methylprop-2-enyl)-3'-prop-2-enylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydropentalene]-1'-carboxylate (PubChem CID 11211143) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is methyl (1'R,2'S,3'R,3'aS,6'aR)-2'-hydroxy-5,5-dimethyl-1'-(2-methylprop-2-enyl)-3'-prop-2-enylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydropentalene]-1'-carboxylate.
| Compound Name | methyl (1'R,2'S,3'R,3'aS,6'aR)-2'-hydroxy-5,5-dimethyl-1'-(2-methylprop-2-enyl)-3'-prop-2-enylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydropentalene]-1'-carboxylate |
|---|---|
| PubChem CID | 11211143 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | methyl (1'R,2'S,3'R,3'aS,6'aR)-2'-hydroxy-5,5-dimethyl-1'-(2-methylprop-2-enyl)-3'-prop-2-enylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydropentalene]-1'-carboxylate |
| SMILES | C=CC[C@@H]1[C@H]2CC3(C[C@H]2[C@@](CC(=C)C)(C(=O)OC)[C@H]1O)OCC(C)(C)CO3 |
| InChI | InChI=1S/C22H34O5/c1-7-8-15-16-10-21(26-12-20(4,5)13-27-21)11-17(16)22(18(15)23,9-14(2)3)19(24)25-6/h7,15-18,23H,1-2,8-13H2,3-6H3/t15-,16-,17-,18+,22-/m1/s1 |
| InChIKey | LKEAETFYJUTFMO-OSAVLUCMSA-N |
| XLogP | 3.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|