C22H25ClN2O2 — CID 11211315
(6aS,13bS)-11-chloro-12-hydroxy-N,N,7-trimethyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxamide (PubChem CID 11211315) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is (6aS,13bS)-11-chloro-12-hydroxy-N,N,7-trimethyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxamide.
| Compound Name | (6aS,13bS)-11-chloro-12-hydroxy-N,N,7-trimethyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 11211315 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (6aS,13bS)-11-chloro-12-hydroxy-N,N,7-trimethyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxamide |
| SMILES | CN(C)C(=O)c1cccc2c1CC[C@H]1[C@H]2c2cc(O)c(Cl)cc2CCN1C |
| InChI | InChI=1S/C22H25ClN2O2/c1-24(2)22(27)16-6-4-5-15-14(16)7-8-19-21(15)17-12-20(26)18(23)11-13(17)9-10-25(19)3/h4-6,11-12,19,21,26H,7-10H2,1-3H3/t19-,21+/m0/s1 |
| InChIKey | WUINVOCRBJOADA-PZJWPPBQSA-N |
| XLogP | 3.68 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |