C20H28F2N2O4 — CID 11211685
(E)-N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-1,4-dihydroxyhexan-2-yl]hex-2-enamide (PubChem CID 11211685) has the molecular formula C20H28F2N2O4 and a molecular weight of 398.45 g/mol. Its IUPAC name is (E)-N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-1,4-dihydroxyhexan-2-yl]hex-2-enamide.
| Compound Name | (E)-N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-1,4-dihydroxyhexan-2-yl]hex-2-enamide |
|---|---|
| PubChem CID | 11211685 |
| Molecular Formula | C20H28F2N2O4 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (E)-N-[(4S,5S)-5-acetamido-6-(3,5-difluorophenyl)-1,4-dihydroxyhexan-2-yl]hex-2-enamide |
| SMILES | CCC/C=C/C(=O)NC(CO)C[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(C)=O |
| InChI | InChI=1S/C20H28F2N2O4/c1-3-4-5-6-20(28)24-17(12-25)11-19(27)18(23-13(2)26)9-14-7-15(21)10-16(22)8-14/h5-8,10,17-19,25,27H,3-4,9,11-12H2,1-2H3,(H,23,26)(H,24,28)/b6-5+/t17?,18-,19-/m0/s1 |
| InChIKey | GOFQCKBWBWQPRE-HMFVNXTCSA-N |
| XLogP | 1.60 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|