About 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole]
2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole] (PubChem CID 11211692) has the molecular formula C29H22N2
and a molecular weight of 398.51 g/mol. Its IUPAC name is 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole].
Molecular Properties
| Compound Name | 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole] |
| PubChem CID | 11211692 |
| Molecular Formula | C29H22N2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole] |
| SMILES | Cc1ccc(C2=NC3(C(c4ccc(C)cc4)=N2)c2ccccc2-c2ccccc23)cc1 |
| InChI | InChI=1S/C29H22N2/c1-19-11-15-21(16-12-19)27-29(31-28(30-27)22-17-13-20(2)14-18-22)25-9-5-3-7-23(25)24-8-4-6-10-26(24)29/h3-18H,1-2H3 |
| InChIKey | YACORQGLYOTXNW-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole]?
The IUPAC name of 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole] (CID 11211692) is 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole].
What is the SMILES notation for 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole]?
The canonical SMILES for 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole] is Cc1ccc(C2=NC3(C(c4ccc(C)cc4)=N2)c2ccccc2-c2ccccc23)cc1.
What is the InChIKey of 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole]?
The InChIKey is YACORQGLYOTXNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22N2/c1-19-11-15-21(16-12-19)27-29(31-28(30-27)22-17-13-20(2)14-18-22)25-9-5-3-7-23(25)24-8-4-6-10-26(24)29/h3-18H,1-2H3.
What are the key properties of 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole]?
2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole] has a molecular weight of 398.51 g/mol, XLogP of 6.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2',5'-bis(4-methylphenyl)spiro[fluorene-9,4'-imidazole] is sourced from PubChem (CID 11211692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).