C17H12FIN2O — CID 11211910
2-(4-fluorophenyl)-3-iodo-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-9-one (PubChem CID 11211910) has the molecular formula C17H12FIN2O and a molecular weight of 406.20 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-iodo-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-9-one.
| Compound Name | 2-(4-fluorophenyl)-3-iodo-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-9-one |
|---|---|
| PubChem CID | 11211910 |
| Molecular Formula | C17H12FIN2O |
| Molecular Weight | 406.20 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 2-(4-fluorophenyl)-3-iodo-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-9-one |
| SMILES | O=C1NCCn2c(-c3ccc(F)cc3)c(I)c3cccc1c32 |
| InChI | InChI=1S/C17H12FIN2O/c18-11-6-4-10(5-7-11)15-14(19)12-2-1-3-13-16(12)21(15)9-8-20-17(13)22/h1-7H,8-9H2,(H,20,22) |
| InChIKey | VUVAHEXALNFTMY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.20 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|