C5F8 — CID 11212
1,2,3,3,4,4,5,5-octafluorocyclopentene (PubChem CID 11212) has the molecular formula C5F8 and a molecular weight of 212.04 g/mol. Its IUPAC name is 1,2,3,3,4,4,5,5-octafluorocyclopentene.
| Compound Name | 1,2,3,3,4,4,5,5-octafluorocyclopentene |
|---|---|
| PubChem CID | 11212 |
| Molecular Formula | C5F8 |
| Molecular Weight | 212.04 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 1,2,3,3,4,4,5,5-octafluorocyclopentene |
| SMILES | FC1=C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5F8/c6-1-2(7)4(10,11)5(12,13)3(1,8)9 |
| InChIKey | YBMDPYAEZDJWNY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.04 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|