C19H29IO2 — CID 11212201
(2R,6R)-2-[(1E,3Z,5R,7E)-8-iodo-3,5,7-trimethylocta-1,3,7-trienyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran (PubChem CID 11212201) has the molecular formula C19H29IO2 and a molecular weight of 416.34 g/mol. Its IUPAC name is (2R,6R)-2-[(1E,3Z,5R,7E)-8-iodo-3,5,7-trimethylocta-1,3,7-trienyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-2-[(1E,3Z,5R,7E)-8-iodo-3,5,7-trimethylocta-1,3,7-trienyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 11212201 |
| Molecular Formula | C19H29IO2 |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (2R,6R)-2-[(1E,3Z,5R,7E)-8-iodo-3,5,7-trimethylocta-1,3,7-trienyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
| SMILES | CC(=C/[C@H](C)C/C(C)=C/I)/C=C/[C@H]1CC=C[C@H](OC(C)C)O1 |
| InChI | InChI=1S/C19H29IO2/c1-14(2)21-19-8-6-7-18(22-19)10-9-15(3)11-16(4)12-17(5)13-20/h6,8-11,13-14,16,18-19H,7,12H2,1-5H3/b10-9+,15-11-,17-13+/t16-,18+,19+/m0/s1 |
| InChIKey | LADIYOHTXXYOBA-DTNGTVRHSA-N |
| XLogP | 5.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|