About 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide
4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide (PubChem CID 11212394) has the molecular formula C17H21N5O6S
and a molecular weight of 423.45 g/mol. Its IUPAC name is 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide |
| PubChem CID | 11212394 |
| Molecular Formula | C17H21N5O6S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide |
| SMILES | CCCN(CCC)c1c([N+](=O)[O-])cc(S(=O)(=O)Nc2ccccn2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N5O6S/c1-3-9-20(10-4-2)17-14(21(23)24)11-13(12-15(17)22(25)26)29(27,28)19-16-7-5-6-8-18-16/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,18,19) |
| InChIKey | SAAXFWVPGNDHGC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 148.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide?
The IUPAC name of 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide (CID 11212394) is 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide.
What is the SMILES notation for 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide?
The canonical SMILES for 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide is CCCN(CCC)c1c([N+](=O)[O-])cc(S(=O)(=O)Nc2ccccn2)cc1[N+](=O)[O-].
What is the InChIKey of 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide?
The InChIKey is SAAXFWVPGNDHGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5O6S/c1-3-9-20(10-4-2)17-14(21(23)24)11-13(12-15(17)22(25)26)29(27,28)19-16-7-5-6-8-18-16/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,18,19).
What are the key properties of 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide?
4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide has a molecular weight of 423.45 g/mol, XLogP of 3.33, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dipropylamino)-3,5-dinitro-N-pyridin-2-ylbenzenesulfonamide is sourced from PubChem (CID 11212394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).