C22H34O6S — CID 11212482
(7S)-1-(benzenesulfonyl)-7-hydroxy-2,2-dimethyl-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octan-3-one (PubChem CID 11212482) has the molecular formula C22H34O6S and a molecular weight of 426.58 g/mol. Its IUPAC name is (7S)-1-(benzenesulfonyl)-7-hydroxy-2,2-dimethyl-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octan-3-one.
| Compound Name | (7S)-1-(benzenesulfonyl)-7-hydroxy-2,2-dimethyl-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octan-3-one |
|---|---|
| PubChem CID | 11212482 |
| Molecular Formula | C22H34O6S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (7S)-1-(benzenesulfonyl)-7-hydroxy-2,2-dimethyl-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octan-3-one |
| SMILES | C[C@H]1OC(C)(C)O[C@@H]1C[C@@H](O)CCCC(=O)C(C)(C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H34O6S/c1-16-19(28-22(4,5)27-16)14-17(23)10-9-13-20(24)21(2,3)15-29(25,26)18-11-7-6-8-12-18/h6-8,11-12,16-17,19,23H,9-10,13-15H2,1-5H3/t16-,17+,19-/m1/s1 |
| InChIKey | XCOSEJHEILRHCV-ZIFCJYIRSA-N |
| XLogP | 3.52 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |