C20H30O10 — CID 11212576
ethyl (1S,2S,3S,4S,6R)-2,3,4-triacetyloxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclohexane-1-carboxylate (PubChem CID 11212576) has the molecular formula C20H30O10 and a molecular weight of 430.45 g/mol. Its IUPAC name is ethyl (1S,2S,3S,4S,6R)-2,3,4-triacetyloxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2S,3S,4S,6R)-2,3,4-triacetyloxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11212576 |
| Molecular Formula | C20H30O10 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | ethyl (1S,2S,3S,4S,6R)-2,3,4-triacetyloxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]([C@H]2COC(C)(C)O2)C[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H30O10/c1-7-25-19(24)16-13(15-9-26-20(5,6)30-15)8-14(27-10(2)21)17(28-11(3)22)18(16)29-12(4)23/h13-18H,7-9H2,1-6H3/t13-,14-,15+,16-,17-,18-/m0/s1 |
| InChIKey | NPCJPKUSPBJKLQ-PCCRXHMLSA-N |
| XLogP | 1.13 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|