C23H14F5NO2 — CID 11212598
[(E)-[phenyl-(2-prop-2-enylphenyl)methylidene]amino] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 11212598) has the molecular formula C23H14F5NO2 and a molecular weight of 431.36 g/mol. Its IUPAC name is [(E)-[phenyl-(2-prop-2-enylphenyl)methylidene]amino] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [(E)-[phenyl-(2-prop-2-enylphenyl)methylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 11212598 |
| Molecular Formula | C23H14F5NO2 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | [(E)-[phenyl-(2-prop-2-enylphenyl)methylidene]amino] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | C=CCc1ccccc1/C(=N/OC(=O)c1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C23H14F5NO2/c1-2-8-13-9-6-7-12-15(13)22(14-10-4-3-5-11-14)29-31-23(30)16-17(24)19(26)21(28)20(27)18(16)25/h2-7,9-12H,1,8H2/b29-22+ |
| InChIKey | MCMBQOTZCVVQHG-QUPMIFSKSA-N |
| XLogP | 5.72 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|