About N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide
N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide (PubChem CID 11212674) has the molecular formula C27H31NO2S
and a molecular weight of 433.62 g/mol. Its IUPAC name is N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide |
| PubChem CID | 11212674 |
| Molecular Formula | C27H31NO2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide |
| SMILES | CCCCCC/C(=C(\c1ccccc1)c1ccc(NS(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H31NO2S/c1-3-4-5-12-17-26(22-13-8-6-9-14-22)27(23-15-10-7-11-16-23)24-18-20-25(21-19-24)28-31(2,29)30/h6-11,13-16,18-21,28H,3-5,12,17H2,1-2H3/b27-26- |
| InChIKey | ZUYRLXUNPGJIIF-RQZHXJHFSA-N |
| XLogP | 6.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide?
The IUPAC name of N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide (CID 11212674) is N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide?
The canonical SMILES for N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide is CCCCCC/C(=C(\c1ccccc1)c1ccc(NS(C)(=O)=O)cc1)c1ccccc1.
What is the InChIKey of N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide?
The InChIKey is ZUYRLXUNPGJIIF-RQZHXJHFSA-N. The full InChI is InChI=1S/C27H31NO2S/c1-3-4-5-12-17-26(22-13-8-6-9-14-22)27(23-15-10-7-11-16-23)24-18-20-25(21-19-24)28-31(2,29)30/h6-11,13-16,18-21,28H,3-5,12,17H2,1-2H3/b27-26-.
What are the key properties of N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide?
N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide has a molecular weight of 433.62 g/mol, XLogP of 6.99, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(Z)-1,2-diphenyloct-1-enyl]phenyl]methanesulfonamide is sourced from PubChem (CID 11212674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).