C23H50O3Si2 — CID 11212707
2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,5,5-tetradeuterioundecan-6-one (PubChem CID 11212707) has the molecular formula C23H50O3Si2 and a molecular weight of 434.85 g/mol. Its IUPAC name is 2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,5,5-tetradeuterioundecan-6-one.
| Compound Name | 2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,5,5-tetradeuterioundecan-6-one |
|---|---|
| PubChem CID | 11212707 |
| Molecular Formula | C23H50O3Si2 |
| Molecular Weight | 434.85 g/mol |
| Exact Mass | 434.35 |
| IUPAC Name | 2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,5,5-tetradeuterioundecan-6-one |
| SMILES | [2H]C([2H])(CC(C)O[Si](C)(C)C(C)(C)C)C([2H])([2H])C(=O)CCCC(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H50O3Si2/c1-19(25-27(9,10)22(3,4)5)15-13-17-21(24)18-14-16-20(2)26-28(11,12)23(6,7)8/h19-20H,13-18H2,1-12H3/i13D2,17D2 |
| InChIKey | JOAZKYPDDWTAGI-VYEBJOFOSA-N |
| XLogP | 7.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.85 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|