C28H42O5 — CID 11213291
[(4S,5S)-5-phenylmethoxyundec-1-en-4-yl] 3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 11213291) has the molecular formula C28H42O5 and a molecular weight of 458.64 g/mol. Its IUPAC name is [(4S,5S)-5-phenylmethoxyundec-1-en-4-yl] 3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | [(4S,5S)-5-phenylmethoxyundec-1-en-4-yl] 3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 11213291 |
| Molecular Formula | C28H42O5 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | [(4S,5S)-5-phenylmethoxyundec-1-en-4-yl] 3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | C=CC[C@H](OC(=O)CC[C@H]1OC(C)(C)O[C@@H]1C=C)[C@H](CCCCCC)OCc1ccccc1 |
| InChI | InChI=1S/C28H42O5/c1-6-9-10-14-18-24(30-21-22-16-12-11-13-17-22)25(15-7-2)31-27(29)20-19-26-23(8-3)32-28(4,5)33-26/h7-8,11-13,16-17,23-26H,2-3,6,9-10,14-15,18-21H2,1,4-5H3/t23-,24+,25+,26-/m1/s1 |
| InChIKey | YZGJZZSJCSUYSX-KEVKATSASA-N |
| XLogP | 6.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|