C23H27F2N5O3 — CID 11213305
N-[1-[(Z)-[(cyanoamino)-(2,5-difluoroanilino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 11213305) has the molecular formula C23H27F2N5O3 and a molecular weight of 459.50 g/mol. Its IUPAC name is N-[1-[(Z)-[(cyanoamino)-(2,5-difluoroanilino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[1-[(Z)-[(cyanoamino)-(2,5-difluoroanilino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 11213305 |
| Molecular Formula | C23H27F2N5O3 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | N-[1-[(Z)-[(cyanoamino)-(2,5-difluoroanilino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NC(/N=C(\NC#N)Nc2cc(F)ccc2F)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C23H27F2N5O3/c1-23(2,3)21(29-20(31)11-14-6-9-18(32-4)19(10-14)33-5)30-22(27-13-26)28-17-12-15(24)7-8-16(17)25/h6-10,12,21H,11H2,1-5H3,(H,29,31)(H2,27,28,30) |
| InChIKey | BCSAKVJLCNBSPQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|