C25H30N6OS — CID 11213399
3-amino-5,6-dimethyl-2-[4-(4-quinolin-2-ylpiperazin-1-yl)butyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 11213399) has the molecular formula C25H30N6OS and a molecular weight of 462.62 g/mol. Its IUPAC name is 3-amino-5,6-dimethyl-2-[4-(4-quinolin-2-ylpiperazin-1-yl)butyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-amino-5,6-dimethyl-2-[4-(4-quinolin-2-ylpiperazin-1-yl)butyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 11213399 |
| Molecular Formula | C25H30N6OS |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 3-amino-5,6-dimethyl-2-[4-(4-quinolin-2-ylpiperazin-1-yl)butyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(CCCCN3CCN(c4ccc5ccccc5n4)CC3)n(N)c(=O)c2c1C |
| InChI | InChI=1S/C25H30N6OS/c1-17-18(2)33-24-23(17)25(32)31(26)22(28-24)9-5-6-12-29-13-15-30(16-14-29)21-11-10-19-7-3-4-8-20(19)27-21/h3-4,7-8,10-11H,5-6,9,12-16,26H2,1-2H3 |
| InChIKey | FEPROLQKWGDFKU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|