C19H34F3N5O5 — CID 11213542
tert-butyl N-[3-[[[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]-[(2,2,2-trifluoroacetyl)amino]methylidene]amino]propyl]carbamate (PubChem CID 11213542) has the molecular formula C19H34F3N5O5 and a molecular weight of 469.51 g/mol. Its IUPAC name is tert-butyl N-[3-[[[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]-[(2,2,2-trifluoroacetyl)amino]methylidene]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]-[(2,2,2-trifluoroacetyl)amino]methylidene]amino]propyl]carbamate |
|---|---|
| PubChem CID | 11213542 |
| Molecular Formula | C19H34F3N5O5 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | tert-butyl N-[3-[[[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]-[(2,2,2-trifluoroacetyl)amino]methylidene]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC/N=C(\NCCCNC(=O)OC(C)(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H34F3N5O5/c1-17(2,3)31-15(29)25-11-7-9-23-14(27-13(28)19(20,21)22)24-10-8-12-26-16(30)32-18(4,5)6/h7-12H2,1-6H3,(H,25,29)(H,26,30)(H2,23,24,27,28) |
| InChIKey | LONHIZPBXZHMLV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|