C30H26N6O — CID 11213916
2-phenyl-N-[[6-[(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)oxymethyl]-2-pyridinyl]methyl]ethanamine (PubChem CID 11213916) has the molecular formula C30H26N6O and a molecular weight of 486.58 g/mol. Its IUPAC name is 2-phenyl-N-[[6-[(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)oxymethyl]-2-pyridinyl]methyl]ethanamine.
| Compound Name | 2-phenyl-N-[[6-[(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)oxymethyl]-2-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 11213916 |
| Molecular Formula | C30H26N6O |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 2-phenyl-N-[[6-[(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)oxymethyl]-2-pyridinyl]methyl]ethanamine |
| SMILES | c1ccc(CCNCc2cccc(COc3nn4c(-c5ccccc5)nnc4c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C30H26N6O/c1-3-10-22(11-4-1)18-19-31-20-24-14-9-15-25(32-24)21-37-30-27-17-8-7-16-26(27)29-34-33-28(36(29)35-30)23-12-5-2-6-13-23/h1-17,31H,18-21H2 |
| InChIKey | BYBVYBPNKHNUTQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|