C26H30N8O2 — CID 11213917
1-[4-(furan-2-yl)-11-octyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(4-methylphenyl)urea (PubChem CID 11213917) has the molecular formula C26H30N8O2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-11-octyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[4-(furan-2-yl)-11-octyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 11213917 |
| Molecular Formula | C26H30N8O2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 1-[4-(furan-2-yl)-11-octyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(4-methylphenyl)urea |
| SMILES | CCCCCCCCn1cc2c(nc(NC(=O)Nc3ccc(C)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C26H30N8O2/c1-3-4-5-6-7-8-15-33-17-20-22(31-33)29-25(30-26(35)27-19-13-11-18(2)12-14-19)34-24(20)28-23(32-34)21-10-9-16-36-21/h9-14,16-17H,3-8,15H2,1-2H3,(H2,27,29,30,31,35) |
| InChIKey | ZBDBVDWBJJEVCU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|