C27H38N2O7 — CID 11214247
tert-butyl (1S,5R,6R,8R,9E)-9-(2-ethoxy-2-oxoethylidene)-8-(hydroxymethyl)-6-[(4-methoxyphenyl)methylcarbamoyl]-2-azabicyclo[3.3.1]nonane-2-carboxylate (PubChem CID 11214247) has the molecular formula C27H38N2O7 and a molecular weight of 502.61 g/mol. Its IUPAC name is tert-butyl (1S,5R,6R,8R,9E)-9-(2-ethoxy-2-oxoethylidene)-8-(hydroxymethyl)-6-[(4-methoxyphenyl)methylcarbamoyl]-2-azabicyclo[3.3.1]nonane-2-carboxylate.
| Compound Name | tert-butyl (1S,5R,6R,8R,9E)-9-(2-ethoxy-2-oxoethylidene)-8-(hydroxymethyl)-6-[(4-methoxyphenyl)methylcarbamoyl]-2-azabicyclo[3.3.1]nonane-2-carboxylate |
|---|---|
| PubChem CID | 11214247 |
| Molecular Formula | C27H38N2O7 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | tert-butyl (1S,5R,6R,8R,9E)-9-(2-ethoxy-2-oxoethylidene)-8-(hydroxymethyl)-6-[(4-methoxyphenyl)methylcarbamoyl]-2-azabicyclo[3.3.1]nonane-2-carboxylate |
| SMILES | CCOC(=O)/C=C1/[C@@H]2[C@H](CO)C[C@@H](C(=O)NCc3ccc(OC)cc3)[C@H]1CCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H38N2O7/c1-6-35-23(31)14-21-20-11-12-29(26(33)36-27(2,3)4)24(21)18(16-30)13-22(20)25(32)28-15-17-7-9-19(34-5)10-8-17/h7-10,14,18,20,22,24,30H,6,11-13,15-16H2,1-5H3,(H,28,32)/b21-14+/t18-,20-,22+,24-/m0/s1 |
| InChIKey | JJNRBBYANXSEQL-DIGRDVBXSA-N |
| XLogP | 3.05 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|