C22H24N2O2Se2 — CID 11214314
2-[2-[[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]diselanyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 11214314) has the molecular formula C22H24N2O2Se2 and a molecular weight of 506.37 g/mol. Its IUPAC name is 2-[2-[[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]diselanyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[2-[[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]diselanyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 11214314 |
| Molecular Formula | C22H24N2O2Se2 |
| Molecular Weight | 506.37 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 2-[2-[[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]diselanyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2ccccc2[Se][Se]c2ccccc2C2=NC(C)(C)CO2)=N1 |
| InChI | InChI=1S/C22H24N2O2Se2/c1-21(2)13-25-19(23-21)15-9-5-7-11-17(15)27-28-18-12-8-6-10-16(18)20-24-22(3,4)14-26-20/h5-12H,13-14H2,1-4H3 |
| InChIKey | HPHVWGDTODVJRK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|