C26H28N8O4 — CID 11214486
ethyl 2-[4-[[4-(furan-2-yl)-11-(3-methylbutyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate (PubChem CID 11214486) has the molecular formula C26H28N8O4 and a molecular weight of 516.56 g/mol. Its IUPAC name is ethyl 2-[4-[[4-(furan-2-yl)-11-(3-methylbutyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[4-(furan-2-yl)-11-(3-methylbutyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 11214486 |
| Molecular Formula | C26H28N8O4 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | ethyl 2-[4-[[4-(furan-2-yl)-11-(3-methylbutyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)Nc2nc3nn(CCC(C)C)cc3c3nc(-c4ccco4)nn23)cc1 |
| InChI | InChI=1S/C26H28N8O4/c1-4-37-21(35)14-17-7-9-18(10-8-17)27-26(36)30-25-29-22-19(15-33(31-22)12-11-16(2)3)24-28-23(32-34(24)25)20-6-5-13-38-20/h5-10,13,15-16H,4,11-12,14H2,1-3H3,(H2,27,29,30,31,36) |
| InChIKey | VBYGSSNTPQTJHH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |