C33H36NO3+ — CID 11214716
(2R,3S,4S)-1,1-dibenzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-1-ium-3-ol (PubChem CID 11214716) has the molecular formula C33H36NO3+ and a molecular weight of 494.66 g/mol. Its IUPAC name is (2R,3S,4S)-1,1-dibenzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-1-ium-3-ol.
| Compound Name | (2R,3S,4S)-1,1-dibenzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-1-ium-3-ol |
|---|---|
| PubChem CID | 11214716 |
| Molecular Formula | C33H36NO3+ |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | (2R,3S,4S)-1,1-dibenzyl-2-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidin-1-ium-3-ol |
| SMILES | COc1ccc(C[C@@H]2[C@H](O)[C@@H](OCc3ccccc3)C[N+]2(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H36NO3/c1-36-30-19-17-26(18-20-30)21-31-33(35)32(37-25-29-15-9-4-10-16-29)24-34(31,22-27-11-5-2-6-12-27)23-28-13-7-3-8-14-28/h2-20,31-33,35H,21-25H2,1H3/q+1/t31-,32+,33+/m1/s1 |
| InChIKey | VDTWJTNPZIKWOW-CEUYOYMZSA-N |
| XLogP | 5.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|