C31H31N7O2 — CID 11214762
4-[4-[3-(dimethylamino)propoxy]anilino]-9-(2,6-dimethylphenyl)-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one (PubChem CID 11214762) has the molecular formula C31H31N7O2 and a molecular weight of 533.64 g/mol. Its IUPAC name is 4-[4-[3-(dimethylamino)propoxy]anilino]-9-(2,6-dimethylphenyl)-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one.
| Compound Name | 4-[4-[3-(dimethylamino)propoxy]anilino]-9-(2,6-dimethylphenyl)-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one |
|---|---|
| PubChem CID | 11214762 |
| Molecular Formula | C31H31N7O2 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 4-[4-[3-(dimethylamino)propoxy]anilino]-9-(2,6-dimethylphenyl)-1,3,5,9,11-pentazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,10,12,14,16-heptaen-8-one |
| SMILES | Cc1cccc(C)c1-n1c(=O)c2cnc(Nc3ccc(OCCCN(C)C)cc3)nc2n2c3ccccc3nc12 |
| InChI | InChI=1S/C31H31N7O2/c1-20-9-7-10-21(2)27(20)38-29(39)24-19-32-30(33-22-13-15-23(16-14-22)40-18-8-17-36(3)4)35-28(24)37-26-12-6-5-11-25(26)34-31(37)38/h5-7,9-16,19H,8,17-18H2,1-4H3,(H,32,33,35) |
| InChIKey | BKTRPBNJGGQIDR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|