C30H44O7Si — CID 11214908
(1S,2R,6R,7R,10R,11S,12S,13S)-7-ethenyl-4,4-dimethyl-12-(phenylmethoxymethyl)-13-(2-trimethylsilylethoxymethoxymethyl)-3,5,9-trioxatetracyclo[8.3.1.02,6.06,11]tetradecan-8-one (PubChem CID 11214908) has the molecular formula C30H44O7Si and a molecular weight of 544.76 g/mol. Its IUPAC name is (1S,2R,6R,7R,10R,11S,12S,13S)-7-ethenyl-4,4-dimethyl-12-(phenylmethoxymethyl)-13-(2-trimethylsilylethoxymethoxymethyl)-3,5,9-trioxatetracyclo[8.3.1.02,6.06,11]tetradecan-8-one.
| Compound Name | (1S,2R,6R,7R,10R,11S,12S,13S)-7-ethenyl-4,4-dimethyl-12-(phenylmethoxymethyl)-13-(2-trimethylsilylethoxymethoxymethyl)-3,5,9-trioxatetracyclo[8.3.1.02,6.06,11]tetradecan-8-one |
|---|---|
| PubChem CID | 11214908 |
| Molecular Formula | C30H44O7Si |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | (1S,2R,6R,7R,10R,11S,12S,13S)-7-ethenyl-4,4-dimethyl-12-(phenylmethoxymethyl)-13-(2-trimethylsilylethoxymethoxymethyl)-3,5,9-trioxatetracyclo[8.3.1.02,6.06,11]tetradecan-8-one |
| SMILES | C=C[C@H]1C(=O)O[C@@H]2C[C@H]3[C@@H](COCOCC[Si](C)(C)C)[C@H](COCc4ccccc4)[C@@H]2[C@@]12OC(C)(C)O[C@H]32 |
| InChI | InChI=1S/C30H44O7Si/c1-7-24-28(31)35-25-15-21-22(17-34-19-32-13-14-38(4,5)6)23(18-33-16-20-11-9-8-10-12-20)26(25)30(24)27(21)36-29(2,3)37-30/h7-12,21-27H,1,13-19H2,2-6H3/t21-,22+,23-,24-,25+,26-,27+,30-/m0/s1 |
| InChIKey | JTJTWIHLPBUDKL-PBDHOZCRSA-N |
| XLogP | 5.03 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|