C28H37ClN4O5 — CID 11214912
[1-[3-(2-chloropyrimidin-4-yl)oxypropyl]cyclobutyl]methyl N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate (PubChem CID 11214912) has the molecular formula C28H37ClN4O5 and a molecular weight of 545.08 g/mol. Its IUPAC name is [1-[3-(2-chloropyrimidin-4-yl)oxypropyl]cyclobutyl]methyl N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate.
| Compound Name | [1-[3-(2-chloropyrimidin-4-yl)oxypropyl]cyclobutyl]methyl N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 11214912 |
| Molecular Formula | C28H37ClN4O5 |
| Molecular Weight | 545.08 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | [1-[3-(2-chloropyrimidin-4-yl)oxypropyl]cyclobutyl]methyl N-[(3S)-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)OCC1(CCCOc2ccnc(Cl)n2)CCC1)C(=O)C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C28H37ClN4O5/c1-3-4-12-22(24(34)25(35)31-20(2)21-10-6-5-7-11-21)32-27(36)38-19-28(14-8-15-28)16-9-18-37-23-13-17-30-26(29)33-23/h5-7,10-11,13,17,20,22H,3-4,8-9,12,14-16,18-19H2,1-2H3,(H,31,35)(H,32,36)/t20-,22+/m1/s1 |
| InChIKey | JVWGALICHYIAPB-IRLDBZIGSA-N |
| XLogP | 5.19 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.08 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|