C30H48NO6P — CID 11214974
[2-methoxy-3-[(8E,10E,12E,14E)-15-phenylpentadeca-8,10,12,14-tetraenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 11214974) has the molecular formula C30H48NO6P and a molecular weight of 549.69 g/mol. Its IUPAC name is [2-methoxy-3-[(8E,10E,12E,14E)-15-phenylpentadeca-8,10,12,14-tetraenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-methoxy-3-[(8E,10E,12E,14E)-15-phenylpentadeca-8,10,12,14-tetraenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 11214974 |
| Molecular Formula | C30H48NO6P |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | [2-methoxy-3-[(8E,10E,12E,14E)-15-phenylpentadeca-8,10,12,14-tetraenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | COC(COCCCCCCC/C=C/C=C/C=C/C=C/c1ccccc1)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C30H48NO6P/c1-31(2,3)24-26-36-38(32,33)37-28-30(34-4)27-35-25-20-15-13-11-9-7-5-6-8-10-12-14-17-21-29-22-18-16-19-23-29/h5-6,8,10,12,14,16-19,21-23,30H,7,9,11,13,15,20,24-28H2,1-4H3/b6-5+,10-8+,14-12+,21-17+ |
| InChIKey | OJVOPJDXTGHVDQ-FVSXFYMKSA-N |
| XLogP | 5.95 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|