C31H36N4O4Si — CID 11215060
(4S)-3-[(2S,4R)-2-azido-5-[tert-butyl(diphenyl)silyl]oxy-4-methylpentanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 11215060) has the molecular formula C31H36N4O4Si and a molecular weight of 556.74 g/mol. Its IUPAC name is (4S)-3-[(2S,4R)-2-azido-5-[tert-butyl(diphenyl)silyl]oxy-4-methylpentanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S,4R)-2-azido-5-[tert-butyl(diphenyl)silyl]oxy-4-methylpentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11215060 |
| Molecular Formula | C31H36N4O4Si |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | (4S)-3-[(2S,4R)-2-azido-5-[tert-butyl(diphenyl)silyl]oxy-4-methylpentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H](N=[N+]=[N-])C(=O)N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C31H36N4O4Si/c1-23(20-27(33-34-32)29(36)35-28(22-38-30(35)37)24-14-8-5-9-15-24)21-39-40(31(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,23,27-28H,20-22H2,1-4H3/t23-,27+,28-/m1/s1 |
| InChIKey | SYFMYMQJFLLCKN-KEKPKEOLSA-N |
| XLogP | 5.99 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|