C29H34N8O4 — CID 11215089
ethyl 2-[4-[[4-(furan-2-yl)-11-octyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate (PubChem CID 11215089) has the molecular formula C29H34N8O4 and a molecular weight of 558.64 g/mol. Its IUPAC name is ethyl 2-[4-[[4-(furan-2-yl)-11-octyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[4-(furan-2-yl)-11-octyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 11215089 |
| Molecular Formula | C29H34N8O4 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | ethyl 2-[4-[[4-(furan-2-yl)-11-octyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
| SMILES | CCCCCCCCn1cc2c(nc(NC(=O)Nc3ccc(CC(=O)OCC)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C29H34N8O4/c1-3-5-6-7-8-9-16-36-19-22-25(34-36)32-28(37-27(22)31-26(35-37)23-11-10-17-41-23)33-29(39)30-21-14-12-20(13-15-21)18-24(38)40-4-2/h10-15,17,19H,3-9,16,18H2,1-2H3,(H2,30,32,33,34,39) |
| InChIKey | ZWZGJPPUAQDYAY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|