C30H54O8Si — CID 11215249
(1R,3S,5R,7R,9R,13R,15S,18S)-7-[tert-butyl(dimethyl)silyl]oxy-13-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxy-18-methyl-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one (PubChem CID 11215249) has the molecular formula C30H54O8Si and a molecular weight of 570.84 g/mol. Its IUPAC name is (1R,3S,5R,7R,9R,13R,15S,18S)-7-[tert-butyl(dimethyl)silyl]oxy-13-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxy-18-methyl-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one.
| Compound Name | (1R,3S,5R,7R,9R,13R,15S,18S)-7-[tert-butyl(dimethyl)silyl]oxy-13-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxy-18-methyl-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
|---|---|
| PubChem CID | 11215249 |
| Molecular Formula | C30H54O8Si |
| Molecular Weight | 570.84 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | (1R,3S,5R,7R,9R,13R,15S,18S)-7-[tert-butyl(dimethyl)silyl]oxy-13-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxy-18-methyl-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
| SMILES | CO[C@H]1C[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](CC(=O)O[C@@H]([C@H]3COC(C)(C)O3)C[C@@H]3CC[C@H](C)[C@@H](C1)O3)O2 |
| InChI | InChI=1S/C30H54O8Si/c1-19-10-11-20-15-26(27-18-33-30(5,6)37-27)36-28(31)17-23-14-24(38-39(8,9)29(2,3)4)13-22(34-23)12-21(32-7)16-25(19)35-20/h19-27H,10-18H2,1-9H3/t19-,20-,21-,22+,23+,24+,25+,26+,27+/m0/s1 |
| InChIKey | AJIZRSVQUVWVIS-PWRNOJCPSA-N |
| XLogP | 5.76 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.84 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|