C33H49NO7Si — CID 11215549
(4R)-4-benzyl-3-[(2R,3S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptanoyl]-1,3-oxazolidin-2-one (PubChem CID 11215549) has the molecular formula C33H49NO7Si and a molecular weight of 599.84 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11215549 |
| Molecular Formula | C33H49NO7Si |
| Molecular Weight | 599.84 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-2,4-dimethylheptanoyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(COCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O)[C@@H](C)C(=O)N2C(=O)OC[C@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H49NO7Si/c1-23(30(35)24(2)31(36)34-27(22-40-32(34)37)20-25-12-10-9-11-13-25)29(41-42(7,8)33(3,4)5)18-19-39-21-26-14-16-28(38-6)17-15-26/h9-17,23-24,27,29-30,35H,18-22H2,1-8H3/t23-,24+,27+,29+,30-/m0/s1 |
| InChIKey | ATEUWQGOZBBSLN-VMZDXHOFSA-N |
| XLogP | 6.22 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.84 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|