C36H47NO6Si — CID 11215701
(2S,4aR,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-2-[3-(methoxymethoxy)propyl]-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one (PubChem CID 11215701) has the molecular formula C36H47NO6Si and a molecular weight of 617.86 g/mol. Its IUPAC name is (2S,4aR,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-2-[3-(methoxymethoxy)propyl]-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one.
| Compound Name | (2S,4aR,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-2-[3-(methoxymethoxy)propyl]-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one |
|---|---|
| PubChem CID | 11215701 |
| Molecular Formula | C36H47NO6Si |
| Molecular Weight | 617.86 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | (2S,4aR,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-2-[3-(methoxymethoxy)propyl]-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one |
| SMILES | COCOCCC[C@@H]1CC[C@@H]2[C@@H](OCc3ccccc3)C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(=O)N2O1 |
| InChI | InChI=1S/C36H47NO6Si/c1-36(2,3)44(30-18-10-6-11-19-30,31-20-12-7-13-21-31)43-34-25-33(41-26-28-15-8-5-9-16-28)32-23-22-29(42-37(32)35(34)38)17-14-24-40-27-39-4/h5-13,15-16,18-21,29,32-34H,14,17,22-27H2,1-4H3/t29-,32-,33+,34+/m1/s1 |
| InChIKey | PUXJEDANXGFIKP-KVGOFSHBSA-N |
| XLogP | 5.61 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.86 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|