C18H20Br4O4 — CID 11215709
(5S,6S,11R,12R)-1,10,11,12-tetrabromo-2,9-dibutyl-4,7-dioxadispiro[4.0.46.25]dodeca-1,9-diene-3,8-dione (PubChem CID 11215709) has the molecular formula C18H20Br4O4 and a molecular weight of 619.97 g/mol. Its IUPAC name is (5S,6S,11R,12R)-1,10,11,12-tetrabromo-2,9-dibutyl-4,7-dioxadispiro[4.0.46.25]dodeca-1,9-diene-3,8-dione.
| Compound Name | (5S,6S,11R,12R)-1,10,11,12-tetrabromo-2,9-dibutyl-4,7-dioxadispiro[4.0.46.25]dodeca-1,9-diene-3,8-dione |
|---|---|
| PubChem CID | 11215709 |
| Molecular Formula | C18H20Br4O4 |
| Molecular Weight | 619.97 g/mol |
| Exact Mass | 615.81 |
| IUPAC Name | (5S,6S,11R,12R)-1,10,11,12-tetrabromo-2,9-dibutyl-4,7-dioxadispiro[4.0.46.25]dodeca-1,9-diene-3,8-dione |
| SMILES | CCCCC1=C(Br)[C@@]2(OC1=O)[C@@H](Br)[C@H](Br)[C@@]21OC(=O)C(CCCC)=C1Br |
| InChI | InChI=1S/C18H20Br4O4/c1-3-5-7-9-11(19)17(25-15(9)23)13(21)14(22)18(17)12(20)10(8-6-4-2)16(24)26-18/h13-14H,3-8H2,1-2H3/t13-,14-,17+,18+/m0/s1 |
| InChIKey | DFESJTKMRBQMAZ-LBTBCDHLSA-N |
| XLogP | 5.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.97 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|