C31H59ClO7Si2 — CID 11215841
2-chloroethyl (E,2R,3S,4S,6R,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-5,11-dioxododec-8-enoate (PubChem CID 11215841) has the molecular formula C31H59ClO7Si2 and a molecular weight of 635.43 g/mol. Its IUPAC name is 2-chloroethyl (E,2R,3S,4S,6R,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-5,11-dioxododec-8-enoate.
| Compound Name | 2-chloroethyl (E,2R,3S,4S,6R,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-5,11-dioxododec-8-enoate |
|---|---|
| PubChem CID | 11215841 |
| Molecular Formula | C31H59ClO7Si2 |
| Molecular Weight | 635.43 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | 2-chloroethyl (E,2R,3S,4S,6R,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-5,11-dioxododec-8-enoate |
| SMILES | CO[C@@H]([C@H](C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](C)C(C)=O)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)OCCCl |
| InChI | InChI=1S/C31H59ClO7Si2/c1-20(24(5)33)19-21(2)26(38-40(13,14)30(6,7)8)22(3)25(34)23(4)27(36-12)28(29(35)37-18-17-32)39-41(15,16)31(9,10)11/h19-20,22-23,26-28H,17-18H2,1-16H3/b21-19+/t20-,22-,23+,26-,27-,28+/m0/s1 |
| InChIKey | MZYZKEORYWWWGX-WTQAGPQBSA-N |
| XLogP | 7.58 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.43 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|