C19H20N2O5S — CID 1121586
(2S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-nitrophenyl)-1,3-thiazolidin-4-one (PubChem CID 1121586) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is (2S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-nitrophenyl)-1,3-thiazolidin-4-one.
| Compound Name | (2S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-nitrophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1121586 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (2S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-nitrophenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CCN2C(=O)CS[C@H]2c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C19H20N2O5S/c1-25-16-8-3-13(11-17(16)26-2)9-10-20-18(22)12-27-19(20)14-4-6-15(7-5-14)21(23)24/h3-8,11,19H,9-10,12H2,1-2H3/t19-/m0/s1 |
| InChIKey | MVYHLVNPNPHADK-IBGZPJMESA-N |
| XLogP | 3.43 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|