C33H38Br2NNiP — CID 11216183
bis(2,4,6-trimethylphenyl)-[[6-(2,4,6-trimethylphenyl)-2-pyridinyl]methyl]phosphane;dibromonickel (PubChem CID 11216183) has the molecular formula C33H38Br2NNiP and a molecular weight of 698.15 g/mol. Its IUPAC name is bis(2,4,6-trimethylphenyl)-[[6-(2,4,6-trimethylphenyl)-2-pyridinyl]methyl]phosphane;dibromonickel.
| Compound Name | bis(2,4,6-trimethylphenyl)-[[6-(2,4,6-trimethylphenyl)-2-pyridinyl]methyl]phosphane;dibromonickel |
|---|---|
| PubChem CID | 11216183 |
| Molecular Formula | C33H38Br2NNiP |
| Molecular Weight | 698.15 g/mol |
| Exact Mass | 695.05 |
| IUPAC Name | bis(2,4,6-trimethylphenyl)-[[6-(2,4,6-trimethylphenyl)-2-pyridinyl]methyl]phosphane;dibromonickel |
| SMILES | Br[Ni]Br.Cc1cc(C)c(-c2cccc(CP(c3c(C)cc(C)cc3C)c3c(C)cc(C)cc3C)n2)c(C)c1 |
| InChI | InChI=1S/C33H38NP.2BrH.Ni/c1-20-13-23(4)31(24(5)14-20)30-12-10-11-29(34-30)19-35(32-25(6)15-21(2)16-26(32)7)33-27(8)17-22(3)18-28(33)9;;;/h10-18H,19H2,1-9H3;2*1H;/q;;;+2/p-2 |
| InChIKey | KIZONVRSVZUHGC-UHFFFAOYSA-L |
| XLogP | 9.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.15 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|