C41H58O7Si2 — CID 11216278
[(2R,3R,5S)-5-[(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methyloxan-2-yl]-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] benzoate (PubChem CID 11216278) has the molecular formula C41H58O7Si2 and a molecular weight of 719.08 g/mol. Its IUPAC name is [(2R,3R,5S)-5-[(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methyloxan-2-yl]-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,5S)-5-[(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methyloxan-2-yl]-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 11216278 |
| Molecular Formula | C41H58O7Si2 |
| Molecular Weight | 719.08 g/mol |
| Exact Mass | 718.37 |
| IUPAC Name | [(2R,3R,5S)-5-[(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methyloxan-2-yl]-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] benzoate |
| SMILES | CO[C@]1([C@@H]2C[C@@H](OC(=O)c3ccccc3)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)OCC[C@@H](C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C41H58O7Si2/c1-30-26-27-44-41(43-8,37(30)48-49(9,10)39(2,3)4)36-28-34(47-38(42)31-20-14-11-15-21-31)35(46-36)29-45-50(40(5,6)7,32-22-16-12-17-23-32)33-24-18-13-19-25-33/h11-25,30,34-37H,26-29H2,1-10H3/t30-,34-,35-,36+,37-,41-/m1/s1 |
| InChIKey | PEDAIZULYLYXAK-GSLKHLIYSA-N |
| XLogP | 7.74 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.08 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|