About hydroxymethyl prop-2-enoate
hydroxymethyl prop-2-enoate (PubChem CID 11217233) has the molecular formula C4H6O3
and a molecular weight of 102.09 g/mol. Its IUPAC name is hydroxymethyl prop-2-enoate.
Molecular Properties
| Compound Name | hydroxymethyl prop-2-enoate |
| PubChem CID | 11217233 |
| Molecular Formula | C4H6O3 |
| Molecular Weight | 102.09 g/mol |
| Exact Mass | 102.03 |
| IUPAC Name | hydroxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCO |
| InChI | InChI=1S/C4H6O3/c1-2-4(6)7-3-5/h2,5H,1,3H2 |
| InChIKey | GJIDOLBZYSCZRX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.09 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hydroxymethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxymethyl prop-2-enoate?
The IUPAC name of hydroxymethyl prop-2-enoate (CID 11217233) is hydroxymethyl prop-2-enoate.
What is the SMILES notation for hydroxymethyl prop-2-enoate?
The canonical SMILES for hydroxymethyl prop-2-enoate is C=CC(=O)OCO.
What is the InChIKey of hydroxymethyl prop-2-enoate?
The InChIKey is GJIDOLBZYSCZRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3/c1-2-4(6)7-3-5/h2,5H,1,3H2.
What are the key properties of hydroxymethyl prop-2-enoate?
hydroxymethyl prop-2-enoate has a molecular weight of 102.09 g/mol, XLogP of -0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethyl prop-2-enoate is sourced from PubChem (CID 11217233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).