About methyl 2-pyrrol-1-ylacetate
methyl 2-pyrrol-1-ylacetate (PubChem CID 11217296) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is methyl 2-pyrrol-1-ylacetate.
Molecular Properties
| Compound Name | methyl 2-pyrrol-1-ylacetate |
| PubChem CID | 11217296 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | methyl 2-pyrrol-1-ylacetate |
| SMILES | COC(=O)Cn1cccc1 |
| InChI | InChI=1S/C7H9NO2/c1-10-7(9)6-8-4-2-3-5-8/h2-5H,6H2,1H3 |
| InChIKey | SDLJOUCIMGIKOD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-pyrrol-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-pyrrol-1-ylacetate?
The IUPAC name of methyl 2-pyrrol-1-ylacetate (CID 11217296) is methyl 2-pyrrol-1-ylacetate.
What is the SMILES notation for methyl 2-pyrrol-1-ylacetate?
The canonical SMILES for methyl 2-pyrrol-1-ylacetate is COC(=O)Cn1cccc1.
What is the InChIKey of methyl 2-pyrrol-1-ylacetate?
The InChIKey is SDLJOUCIMGIKOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-10-7(9)6-8-4-2-3-5-8/h2-5H,6H2,1H3.
What are the key properties of methyl 2-pyrrol-1-ylacetate?
methyl 2-pyrrol-1-ylacetate has a molecular weight of 139.15 g/mol, XLogP of 0.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-pyrrol-1-ylacetate is sourced from PubChem (CID 11217296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).