C6H12N2S — CID 11217325
5,6-dimethyl-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 11217325) has the molecular formula C6H12N2S and a molecular weight of 144.24 g/mol. Its IUPAC name is 5,6-dimethyl-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | 5,6-dimethyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 11217325 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 5,6-dimethyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CC1CN=C(N)SC1C |
| InChI | InChI=1S/C6H12N2S/c1-4-3-8-6(7)9-5(4)2/h4-5H,3H2,1-2H3,(H2,7,8) |
| InChIKey | SQSBYAOEOUCHQW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |