2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid

C5H7NO4 — CID 11217327

IUPAC2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid
SMILESO=C(O)C[C@@H]1CNC(=O)O1
InChIInChI=1S/C5H7NO4/c7-4(8)1-3-2-6-5(9)10-3/h3H,1-2H2,(H,6,9)(H,7,8)/t3-/m1/s1
InChIKeyMTZFESAXMFTYQB-GSVOUGTGSA-N
MW145.11 g/mol
LogP-0.43
Rot. Bonds2

About 2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid

2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid (PubChem CID 11217327) has the molecular formula C5H7NO4 and a molecular weight of 145.11 g/mol. Its IUPAC name is 2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid.

Molecular Properties

Compound Name2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid
PubChem CID11217327
Molecular FormulaC5H7NO4
Molecular Weight145.11 g/mol
Exact Mass145.04
IUPAC Name2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid
SMILESO=C(O)C[C@@H]1CNC(=O)O1
InChIInChI=1S/C5H7NO4/c7-4(8)1-3-2-6-5(9)10-3/h3H,1-2H2,(H,6,9)(H,7,8)/t3-/m1/s1
InChIKeyMTZFESAXMFTYQB-GSVOUGTGSA-N
XLogP-0.43
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.11
LogP ≤ 5-0.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid?
The IUPAC name of 2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid (CID 11217327) is 2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid.
What is the SMILES notation for 2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid?
The canonical SMILES for 2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid is O=C(O)C[C@@H]1CNC(=O)O1.
What is the InChIKey of 2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid?
The InChIKey is MTZFESAXMFTYQB-GSVOUGTGSA-N. The full InChI is InChI=1S/C5H7NO4/c7-4(8)1-3-2-6-5(9)10-3/h3H,1-2H2,(H,6,9)(H,7,8)/t3-/m1/s1.
What are the key properties of 2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid?
2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid has a molecular weight of 145.11 g/mol, XLogP of -0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5R)-2-oxo-1,3-oxazolidin-5-yl]acetic acid is sourced from PubChem (CID 11217327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).