About azulene-1-carbonitrile
azulene-1-carbonitrile (PubChem CID 11217357) has the molecular formula C11H7N
and a molecular weight of 153.18 g/mol. Its IUPAC name is azulene-1-carbonitrile.
Molecular Properties
| Compound Name | azulene-1-carbonitrile |
| PubChem CID | 11217357 |
| Molecular Formula | C11H7N |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | azulene-1-carbonitrile |
| SMILES | N#Cc1ccc2cccccc1-2 |
| InChI | InChI=1S/C11H7N/c12-8-10-7-6-9-4-2-1-3-5-11(9)10/h1-7H |
| InChIKey | NOUOSAZUOXMSHD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azulene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azulene-1-carbonitrile?
The IUPAC name of azulene-1-carbonitrile (CID 11217357) is azulene-1-carbonitrile.
What is the SMILES notation for azulene-1-carbonitrile?
The canonical SMILES for azulene-1-carbonitrile is N#Cc1ccc2cccccc1-2.
What is the InChIKey of azulene-1-carbonitrile?
The InChIKey is NOUOSAZUOXMSHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N/c12-8-10-7-6-9-4-2-1-3-5-11(9)10/h1-7H.
What are the key properties of azulene-1-carbonitrile?
azulene-1-carbonitrile has a molecular weight of 153.18 g/mol, XLogP of 2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azulene-1-carbonitrile is sourced from PubChem (CID 11217357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).