About (3S)-3,7-dimethyloctan-1-amine
(3S)-3,7-dimethyloctan-1-amine (PubChem CID 11217386) has the molecular formula C10H23N
and a molecular weight of 157.30 g/mol. Its IUPAC name is (3S)-3,7-dimethyloctan-1-amine.
Molecular Properties
| Compound Name | (3S)-3,7-dimethyloctan-1-amine |
| PubChem CID | 11217386 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | (3S)-3,7-dimethyloctan-1-amine |
| SMILES | CC(C)CCC[C@H](C)CCN |
| InChI | InChI=1S/C10H23N/c1-9(2)5-4-6-10(3)7-8-11/h9-10H,4-8,11H2,1-3H3/t10-/m0/s1 |
| InChIKey | PPKSYRUVTABEIE-JTQLQIEISA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-3,7-dimethyloctan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3,7-dimethyloctan-1-amine?
The IUPAC name of (3S)-3,7-dimethyloctan-1-amine (CID 11217386) is (3S)-3,7-dimethyloctan-1-amine.
What is the SMILES notation for (3S)-3,7-dimethyloctan-1-amine?
The canonical SMILES for (3S)-3,7-dimethyloctan-1-amine is CC(C)CCC[C@H](C)CCN.
What is the InChIKey of (3S)-3,7-dimethyloctan-1-amine?
The InChIKey is PPKSYRUVTABEIE-JTQLQIEISA-N. The full InChI is InChI=1S/C10H23N/c1-9(2)5-4-6-10(3)7-8-11/h9-10H,4-8,11H2,1-3H3/t10-/m0/s1.
What are the key properties of (3S)-3,7-dimethyloctan-1-amine?
(3S)-3,7-dimethyloctan-1-amine has a molecular weight of 157.30 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,7-dimethyloctan-1-amine is sourced from PubChem (CID 11217386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).