About 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine
5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 11217389) has the molecular formula C8H6N4
and a molecular weight of 158.16 g/mol. Its IUPAC name is 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 11217389 |
| Molecular Formula | C8H6N4 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C#Cc1c[nH]c2ncnc(N)c12 |
| InChI | InChI=1S/C8H6N4/c1-2-5-3-10-8-6(5)7(9)11-4-12-8/h1,3-4H,(H3,9,10,11,12) |
| InChIKey | NASVPSCCMRQGPR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CID 11217389) is 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine is C#Cc1c[nH]c2ncnc(N)c12.
What is the InChIKey of 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is NASVPSCCMRQGPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4/c1-2-5-3-10-8-6(5)7(9)11-4-12-8/h1,3-4H,(H3,9,10,11,12).
What are the key properties of 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 158.16 g/mol, XLogP of 0.52, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 11217389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).