About 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde
7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde (PubChem CID 11217550) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde.
Molecular Properties
| Compound Name | 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde |
| PubChem CID | 11217550 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde |
| SMILES | CC12CCCC(C=O)=C1C=CC2=O |
| InChI | InChI=1S/C11H12O2/c1-11-6-2-3-8(7-12)9(11)4-5-10(11)13/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | ACXRKYSWGLYIQM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde?
The IUPAC name of 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde (CID 11217550) is 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde.
What is the SMILES notation for 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde?
The canonical SMILES for 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde is CC12CCCC(C=O)=C1C=CC2=O.
What is the InChIKey of 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde?
The InChIKey is ACXRKYSWGLYIQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-11-6-2-3-8(7-12)9(11)4-5-10(11)13/h4-5,7H,2-3,6H2,1H3.
What are the key properties of 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde?
7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde has a molecular weight of 176.22 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7a-methyl-1-oxo-6,7-dihydro-5H-indene-4-carbaldehyde is sourced from PubChem (CID 11217550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).