About 2-(4-chlorophenyl)-2,5-dihydrofuran
2-(4-chlorophenyl)-2,5-dihydrofuran (PubChem CID 11217596) has the molecular formula C10H9ClO
and a molecular weight of 180.63 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2,5-dihydrofuran.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-2,5-dihydrofuran |
| PubChem CID | 11217596 |
| Molecular Formula | C10H9ClO |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 2-(4-chlorophenyl)-2,5-dihydrofuran |
| SMILES | Clc1ccc(C2C=CCO2)cc1 |
| InChI | InChI=1S/C10H9ClO/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-6,10H,7H2 |
| InChIKey | DZPHDURVWFESPE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-2,5-dihydrofuran?
The IUPAC name of 2-(4-chlorophenyl)-2,5-dihydrofuran (CID 11217596) is 2-(4-chlorophenyl)-2,5-dihydrofuran.
What is the SMILES notation for 2-(4-chlorophenyl)-2,5-dihydrofuran?
The canonical SMILES for 2-(4-chlorophenyl)-2,5-dihydrofuran is Clc1ccc(C2C=CCO2)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-2,5-dihydrofuran?
The InChIKey is DZPHDURVWFESPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClO/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-6,10H,7H2.
What are the key properties of 2-(4-chlorophenyl)-2,5-dihydrofuran?
2-(4-chlorophenyl)-2,5-dihydrofuran has a molecular weight of 180.63 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-2,5-dihydrofuran is sourced from PubChem (CID 11217596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).